Home
Products
(+)-Longifolene
| Product Name | (+)-Longifolene |
| Price: | Inquiry |
| Catalog No.: | CN06437 |
| CAS No.: | 475-20-7 |
| Molecular Formula: | C15H24 |
| Molecular Weight: | 204.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Oil |
| Source: | The leaf oil of Chamaecyparis nootkatensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C1[C@H]2CC[C@H]3[C@]1(C)CCCC([C@@H]23)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (+)-Longifolene is a sesquiterpenoid and a metabolite in rabbits. (+)-Longifolen is converted to primary, secondary or tertiary alcohols in rabbits, among which the primary alcohol is predominant[1]. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 252.2±7.0 °C at 760 mmHg |
| Flash Point | 101.1±0.0 °C |
| Exact Mass | 204.187805 |
| LogP | 6.39 |
| Vapour Pressure | 0.0±0.2 mmHg at 25°C |
| Storage condition | 2-8°C |