Home
Products
Veratrosine
| Product Name | Veratrosine |
| Price: | Inquiry |
| Catalog No.: | CN00768 |
| CAS No.: | 475-00-3 |
| Molecular Formula: | C33H49NO7 |
| Molecular Weight: | 571.75 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Veratrum nigrum L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2CC[C@]3(C(=CC[C@@H]4[C@@H]3Cc3c4ccc(c3C)[C@@H]([C@@H]3NC[C@H](C[C@H]3O)C)C)C2)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Veratramine is a steroidal alkaloid extracted from the roots and rhizomes of Veratrum californicum[1]. |
| Density | 1.29 g/cm3 |
| Boiling Point | 740.7±60.0℃ at 760 mmHg |
| Exact Mass | 571.35100 |
| PSA | 131.64000 |
| LogP | 2.74750 |
| Vapour Pressure | 4.91E-23mmHg at 25°C |
| Storage condition | 2-8℃ |