Home
Products
Brazilin
| Product Name | Brazilin |
| Price: | $80 / 20mg |
| Catalog No.: | CN05363 |
| CAS No.: | 474-07-7 |
| Molecular Formula: | C16H14O5 |
| Molecular Weight: | 286.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Red powder |
| Source: | The heartwoods of Caesalpinia sappan L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc2c(c1)OC[C@]1([C@@H]2c2cc(O)c(cc2C1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Brazilin is a red dye precursor obtained from the heartwood of several species of tropical hardwoods. Brazilin inhibits the cells proliferation, promotes apoptosis, and induces autophagy through the AMPK/mTOR pathway. Brazilin shows chondroprotective and anti-inflammatory activities[1][2][3]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 555.8±50.0 °C at 760 mmHg |
| Flash Point | 289.9±30.1 °C |
| Exact Mass | 286.084137 |
| PSA | 90.15000 |
| LogP | 1.32 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |