Home
Products
beta-Cryptoxanthin
| Product Name | beta-Cryptoxanthin |
| Price: | Inquiry |
| Catalog No.: | CN06377 |
| CAS No.: | 472-70-8 |
| Molecular Formula: | C40H56O |
| Molecular Weight: | 552.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The fruits of Zea mays L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1CC(=C(C(C1)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C1=C(C)CCCC1(C)C)C)C)/C)/C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | β-Cryptoxanthin ((3R)-β-Cryptoxanthin), isolated from Satsuma mandarin orange, is an oxygenated carotenoid and a potent antioxidant. β-Cryptoxanthin has an anti-stress effect[1]. |
| Target | Human Endogenous Metabolite |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 682.9±34.0 °C at 760 mmHg |
| Flash Point | 293.7±17.9 °C |
| Exact Mass | 552.433105 |
| PSA | 20.23000 |
| LogP | 13.67 |
| Vapour Pressure | 0.0±4.8 mmHg at 25°C |