Home
Products
Astaxanthin
| Product Name | Astaxanthin |
| Price: | $58 / 20mg |
| Catalog No.: | CN06650 |
| CAS No.: | 472-61-7 |
| Molecular Formula: | C40H52O4 |
| Molecular Weight: | 596.85 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Red powder |
| Source: | From Haematococcus Pluvialis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C(=CC=CC=C(C=CC=C(C=CC1=C(C)C(=O)[C@H](CC1(C)C)O)/C)/C)/C=C/C=C(/C=C/C1=C(C)C(=O)[C@H](CC1(C)C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Astaxanthin, a red dietary carotenoid isolated from Haematococcus pluvialis, is an inhibitor of PPARγ and a potent antioxidant with antiproliferative, neuroprotective and anti-inflammatory activity[1]. Astaxanthin has potential in the treatment of various diseases, such as cancers and Parkinson’s disease, cardiovascular disease[2]. Due to its bright red colour, Astaxanthin could be used as a food colorant in animal feeds[3]. |
| Target | PPARγ |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 774.0±60.0 °C at 760 mmHg |
| Flash Point | 435.8±29.4 °C |
| Exact Mass | 596.386536 |
| PSA | 74.60000 |
| LogP | 8.16 |
| Vapour Pressure | 0.0±6.0 mmHg at 25°C |
| Storage condition | −20°C |