Home
Products
Telocinobufagin
| Product Name | Telocinobufagin |
| Price: | $263 / 10mg |
| Catalog No.: | CN02482 |
| CAS No.: | 472-26-4 |
| Molecular Formula: | C24H34O5 |
| Molecular Weight: | 402.52 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The glandular body of Bufo bufo gargarizans Cantor. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1CC[C@]2([C@](C1)(O)CC[C@@H]1[C@@H]2CC[C@]2([C@]1(O)CC[C@@H]2c1ccc(=O)oc1)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Telocinobufagin is one of anti-hepatoma constituent in Venenum Bufonis. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 589.6±50.0 °C at 760 mmHg |
| Flash Point | 201.0±23.6 °C |
| Exact Mass | 402.240631 |
| PSA | 90.90000 |
| LogP | 1.78 |
| Vapour Pressure | 0.0±3.8 mmHg at 25°C |
| Storage condition | -20°C |