Home
Products
Ruscogenin
| Product Name | Ruscogenin |
| Price: | $103 / 20mg |
| Catalog No.: | CN02588 |
| CAS No.: | 472-11-7 |
| Molecular Formula: | C27H42O4 |
| Molecular Weight: | 430.63 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | White powder |
| Source: | The roots of Ophiopogon japonicus. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@@H]1CC[C@@]2(OC1)O[C@@H]1[C@H]([C@@H]2C)[C@@]2([C@@H](C1)[C@@H]1CC=C3[C@]([C@H]1CC2)(C)[C@H](O)C[C@@H](C3)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ruscogenin, an important steroid sapogenin derived from Ophiopogon japonicus, attenuates cerebral ischemia-induced blood-brain barrier dysfunction by suppressing TXNIP/NLRP3 inflammasome activation and the MAPK pathway and exerts significant anti-inflammatory and anti-thrombotic activities[1][2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 563.1±50.0 °C at 760 mmHg |
| Flash Point | 294.4±30.1 °C |
| Exact Mass | 430.308319 |
| PSA | 58.92000 |
| LogP | 4.29 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
| Storage condition | 2~8℃ |