Home
Products
Steviol
| Product Name | Steviol |
| Price: | $103 / 20mg |
| Catalog No.: | CN08249 |
| CAS No.: | 471-80-7 |
| Molecular Formula: | C20H30O3 |
| Molecular Weight: | 318.45 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Stevia rebaudiana |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)[C@]1(C)CCC[C@]2([C@H]1CC[C@]13[C@@H]2CC[C@](C3)(C(=C)C1)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Steviol is a major metabolite of the sweetening compound stevioside. Steviol slows renal cyst growth by reducing AQP2 expression and promoting AQP2 degradation[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 464.5±45.0 °C at 760 mmHg |
| Flash Point | 248.8±25.2 °C |
| Exact Mass | 318.219482 |
| PSA | 57.53000 |
| LogP | 4.44 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
| Storage condition | 2-8C |