Home
Products
Zerumbone
| Product Name | Zerumbone |
| Price: | $46 / 20mg |
| Catalog No.: | CN09035 |
| CAS No.: | 471-05-6 |
| Molecular Formula: | C15H22O |
| Molecular Weight: | 218.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Oil |
| Source: | The herbs of Zingiber officinale |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC1=CCC(C)(C)C=CC(=O)C(=CCC1)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Zerumbone is a monocyclic sesquiterpene compound isolated from the rhizomes of Zingiber zerumbet Smith. Zerumbone potently inhibits the activation of Epstein-Barr virus with an IC50 of 0.14 mM. Zerumbone has anti-cancer, antioxidant, anti-inflammatory and anti-proliferative activity[1][2]. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 321.6±42.0 °C at 760 mmHg |
| Flash Point | 133.9±22.8 °C |
| Exact Mass | 218.167068 |
| PSA | 17.07000 |
| LogP | 5.34 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Storage condition | 2-8℃ |