Home
Products
5'-IMPdisodium salt
| Product Name | 5'-IMPdisodium salt |
| Price: | Inquiry |
| Catalog No.: | CN00788 |
| CAS No.: | 4691-65-0 |
| Molecular Formula: | C10H11N4Na2O8P |
| Molecular Weight: | 392.17 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Beta vulgaris |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1[C@H](O)[C@H](O[C@H]1n1cnc2c1ncnc2O)COP(=O)([O-])[O-].[Na+].[Na+] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Disodium 5'-inosinate, obtained from bacterial fermentation of sugars, is as a food additive and often found in a variety of other snacks. |
| Density | 2.31g/cm3 |
| Boiling Point | 851.4ºC at 760 mmHg |
| Flash Point | 468.7ºC |
| Exact Mass | 392.010986 |
| PSA | 195.49000 |
| Storage condition | 2-8°C |