Home
Products
(-)-alpha-Cedrene
| Product Name | (-)-alpha-Cedrene |
| Price: | Inquiry |
| Catalog No.: | CN08993 |
| CAS No.: | 469-61-4 |
| Molecular Formula: | C15H24 |
| Molecular Weight: | 204.35 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Oil |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC1=CC[C@@]23C[C@@H]1C(C)(C)[C@@H]2CC[C@H]3C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (-)-Cedrene (α-cedrene) is a sesquiterpene constituent of cedarwood oils, with anti-leukemic, antimicrobial and anti-obesity activities[1]. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 262.5±7.0 °C at 760 mmHg |
| Flash Point | 110.2±6.6 °C |
| Exact Mass | 204.187805 |
| LogP | 6.38 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |