Home
Products
Hamamelitannin
| Product Name | Hamamelitannin |
| Price: | Inquiry |
| Catalog No.: | CN03418 |
| CAS No.: | 469-32-9 |
| Molecular Formula: | C20H20O14 |
| Molecular Weight: | 484.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Hamamelis virginiana L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(c1cc(O)c(c(c1)O)O)OC[C@@H]1OC([C@]([C@H]1O)(O)COC(=O)c1cc(O)c(c(c1)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hamamelitannin, a polyphenol extracted from the bark of Hamamelis virginiana, is a quorum-sensing (QS) inhibitor. Hamamelitannin increases antibiotic susceptibility of staphylococcus aureus biofilms by affecting peptidoglycan biosynthesis and eDNA release[1][2]. |
| In Vitro | Hamamelitannin displays specific cytotoxic activity against colon cancer cells[3]. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 941.7±65.0 °C at 760 mmHg |
| Flash Point | 329.0±27.8 °C |
| Exact Mass | 484.085297 |
| PSA | 243.90000 |
| LogP | 2.91 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |