Home
Products
Cryptomeridiol
| Product Name | Cryptomeridiol |
| Price: | Inquiry |
| Catalog No.: | CN09429 |
| CAS No.: | 4666-84-6 |
| Molecular Formula: | C15H28O2 |
| Molecular Weight: | 240.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Oil |
| Source: | The herbs of Blumea balsamifera DC |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(C1CCC2(C(C1)C(C)(O)CCC2)C)(O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 317.3±10.0 °C at 760 mmHg |
| Flash Point | 137.3±13.6 °C |
| Exact Mass | 240.208923 |
| PSA | 40.46000 |
| LogP | 3.09 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |