Home
Products
Bullatine B
| Product Name | Bullatine B |
| Price: | Inquiry |
| Catalog No.: | CN01390 |
| CAS No.: | 466-26-2 |
| Molecular Formula: | C24H39NO6 |
| Molecular Weight: | 337.57 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Aconitum brachypodum Diels |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC[C@]12CC[C@@H]([C@@]34[C@@H]2[C@@H](OC)[C@@H](C3N(C1)CC)[C@@]1([C@@H]2[C@H]4C[C@@H]([C@@H]2O)[C@H](C1)OC)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Neoline, the active ingredient of processed aconite root (PA), alleviated oxaliplatin-induced peripheral neuropathy in mice. Neoline can be used as a marker compound to determine the quality of the PA products for the treatment of neuropathic pain[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 578.3±50.0 °C at 760 mmHg |
| Flash Point | 303.5±30.1 °C |
| Exact Mass | 437.277740 |
| PSA | 91.62000 |
| LogP | -1.69 |
| Vapour Pressure | 0.0±3.6 mmHg at 25°C |