Home
Products
Marrubiin
| Product Name | Marrubiin |
| Price: | Inquiry |
| Catalog No.: | CN08213 |
| CAS No.: | 465-92-9 |
| Molecular Formula: | C20H28O4 |
| Molecular Weight: | 332.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Marrubium alysson |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC1CC2OC(=O)C3(C2C(C1(O)CCc1cocc1)(C)CCC3)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Marrubiin, isolated from Marrubium vulgare, exhibits vasorelaxant and antioedematogenic activity. Marrubiin alleviates diabetic symptoms in animals[1][2][3]. |
| Density | 1.152g/cm3 |
| Boiling Point | 465.2ºC at 760mmHg |
| Flash Point | 235.2ºC |
| Exact Mass | 332.19900 |
| PSA | 59.67000 |
| LogP | 3.72120 |
| Vapour Pressure | 1.87E-09mmHg at 25°C |