Home
Products
Hellebrigenin
| Product Name | Hellebrigenin |
| Price: | $409 / 5mg |
| Catalog No.: | CN06477 |
| CAS No.: | 465-90-7 |
| Molecular Formula: | C24H32O6 |
| Molecular Weight: | 416.51 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The glandular body of Bufo bufo gargarizans Cantor. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=CC12CCC(CC2(O)CCC2C1CCC1(C2(O)CCC1c1ccc(=O)oc1)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hellebrigenin, one of bufadienolides belonging to cardioactive steroids, is isolated from traditional Chinese medicine Venenum Bufonis. Hellebrigenin induces DNA damage and cell cycle G2/M arrest. Hellebrigenin triggers mitochondria-mediated apoptosis. |
| Density | 1.419g/cm3 |
| Boiling Point | 626.3ºC at 760 mmHg |
| Flash Point | 215ºC |
| Exact Mass | 416.22000 |
| PSA | 107.97000 |
| LogP | 2.53580 |