Home
Products
Capsanthin
| Product Name | Capsanthin |
| Price: | Inquiry |
| Catalog No.: | CN06378 |
| CAS No.: | 465-42-9 |
| Molecular Formula: | C40H56O3 |
| Molecular Weight: | 584.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The fruits of Capsicum annuum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C(=CC=CC=C(C=CC=C(C=CC1=C(C)C[C@H](CC1(C)C)O)/C)/C)/C=C/C=C(/C=C/C(=O)[C@]1(C)C[C@H](CC1(C)C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Capsanthin is a carotenoid that has been found in C. annuum. Capsanthin has antioxidant[1]、antitumor[2] and anti-inflammatory[3] effects. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 726.6±60.0 °C at 760 mmHg |
| Flash Point | 407.2±29.4 °C |
| Exact Mass | 584.422974 |
| PSA | 57.53000 |
| LogP | 9.90 |
| Vapour Pressure | 0.0±5.4 mmHg at 25°C |