Home
Products
Resibufogenin
| Product Name | Resibufogenin |
| Price: | $103 / 20mg |
| Catalog No.: | CN02537 |
| CAS No.: | 465-39-4 |
| Molecular Formula: | C24H32O4 |
| Molecular Weight: | 384.51 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The glandular body of Bufo bufo gargarizans Cantor |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1CC[C@]2([C@@H](C1)CC[C@@H]1[C@@H]2CC[C@]2([C@]31O[C@@H]3C[C@@H]2c1ccc(=O)oc1)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Resibufogenin, a component of huachansu, has been shown to exhibit the anti-proliferative effect against cancer cells, and this may be attributed to the degradation of cyclin D1 caused by the activation of GSK-3β.IC50 Value:Target:In vitro: The effects of Resibufogenin on the outward delayed rectifier potassium current (IK) and outward transient potassium current (IA) in rat hippocampal neurons was investigated, and it inhibited both IK and IA, at 1 μM concentration RBG could alter some channel kinetics and gating properties of IK, such as steady-state activation and inactivation curves, open probability and time constants [1].In vivo: Resibufogenin prevented evidence of oxidative stress in "preeclamptic" rats [2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 554.9±50.0 °C at 760 mmHg |
| Flash Point | 190.7±23.6 °C |
| Exact Mass | 384.230072 |
| PSA | 62.97000 |
| LogP | 2.89 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |