Home
Products
Polyporenic acid C
| Product Name | Polyporenic acid C |
| Price: | $263 / 10mg |
| Catalog No.: | CN07609 |
| CAS No.: | 465-18-9 |
| Molecular Formula: | C31H46O4 |
| Molecular Weight: | 482.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Wolfiporia cocos (Schw.) Ryv. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(C(=C)CC[C@H]([C@H]1[C@H](O)C[C@@]2([C@]1(C)CC=C1C2=CC[C@@H]2[C@]1(C)CCC(=O)C2(C)C)C)C(=O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Polyporenic acid C is a lanostane-type triterpenoid isolated from P. cocos. Polyporenic acid C induces cell apoptosis through the death receptor-mediated apoptotic pathway without the involvement of the mitochondria. Polyporenic acid C is promising agent for lung cancer therapy[1]. |
| Target | IC50: apoptosis[1] |
| Exact Mass | 482.34000 |
| PSA | 74.60000 |
| LogP | 6.74480 |
| Storage condition | 2-8℃ |