Home
Products
(+)-Camphor
| Product Name | (+)-Camphor |
| Price: | $15 / 20mg |
| Catalog No.: | CN09628 |
| CAS No.: | 464-49-3 |
| Molecular Formula: | C10H16O |
| Molecular Weight: | 152.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | Powder |
| Source: | The oil of Ocimum kilimandscharicum. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1C[C@@H]2C([C@@]1(C)CC2)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (+)-Camphor is an ingredient in cooking, and as an embalming fluid for medicinal purposes, |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 207.4±0.0 °C at 760 mmHg |
| Flash Point | 64 ºC |
| Exact Mass | 152.120117 |
| PSA | 17.07000 |
| LogP | 2.13 |
| Vapour Pressure | 0.2±0.4 mmHg at 25°C |