Home
Products
Larixyl acetate
| Product Name | Larixyl acetate |
| Price: | Inquiry |
| Catalog No.: | CN08214 |
| CAS No.: | 4608-49-5 |
| Molecular Formula: | C22H36O3 |
| Molecular Weight: | 348.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The branches of Larix decidua |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C[C@](CC[C@H]1C(=C)C[C@@H]([C@@H]2[C@]1(C)CCCC2(C)C)OC(=O)C)(O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Larixyl acetate is a potent and selective TRPC6 inhibitor with IC50 values of 0.58 μM and 6.83 μM against hTRPC6-YFP and hTRPC3-YFP, respectively. Larixyl acetate prevents HPV and is effective in protecting against traumatic brain injury-induced systemic endothelial dysfunction[1][2]. |
| Target | hTRPC6:0.58 μM (IC50) hTRPC3:6.83 μM (IC50) |
| Density | 1.00±0.1 g/cm3 (20ºC 760 Torr) |
| Boiling Point | 419.3±28.0 °C |
| Exact Mass | 348.26600 |
| PSA | 46.53000 |
| LogP | 5.04400 |
| Storage condition | ?20°C |