Home
Products
Aegeline
| Product Name | Aegeline |
| Price: | $46 / 20mg |
| Catalog No.: | CN00713 |
| CAS No.: | 456-12-2 |
| Molecular Formula: | C18H19NO3 |
| Molecular Weight: | 297.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Cannabis sativa L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)C(CNC(=O)/C=C/c1ccccc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Aegeline, a main alkaloid, mimics the yeast SNARE protein Sec22p in suppressing α-synuclein and Bax toxicity in yeast. Aegeline restores growth of yeast cells suppressed by either αsyn or Bax. Antioxidant activity[1]. |
| In Vitro | Aegeline also prevents growth block in cells expressing the more toxic A53T α-synuclein mutant. Restoration of cell growth occurred through inhibition of increased ROS levels, mitochondrial membrane potential loss and nuclear DNA fragmentation, characteristics of apoptosis manifested in α-synuclein orBax-expressing cells[1]. Aegeline shows weak inhibitory effects on the histamine release from RPMCs, even though still succeed to inhibit when the histamine release induced by thapsigargin[2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 567.7±50.0 °C at 760 mmHg |
| Flash Point | 297.1±30.1 °C |
| Exact Mass | 297.136505 |
| PSA | 62.05000 |
| LogP | 2.45 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Storage condition | 2-8°C |