Home
Products
Indaconitine
| Product Name | Indaconitine |
| Price: | Inquiry |
| Catalog No.: | CN02203 |
| CAS No.: | 4491-19-4 |
| Molecular Formula: | C34H47NO10 |
| Molecular Weight: | 629.82 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | White powder |
| Source: | The roots of Aconitum carmichaeli Debx. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC[C@@]12CN(CC)C3C4([C@@H]2[C@@H](OC)C3[C@@]2([C@@H]3[C@H]4C[C@@]([C@@H]3OC(=O)c3ccccc3)([C@H](C2)OC)O)OC(=O)C)[C@H](C[C@H]1O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Indaconitine is a natural product. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 692.8±55.0 °C at 760 mmHg |
| Flash Point | 372.8±31.5 °C |
| Exact Mass | 629.320007 |
| PSA | 133.22000 |
| LogP | 0.54 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Storage condition | 2-8℃ |