Home
Products
Norwogonin
| Product Name | Norwogonin |
| Price: | $293 / 10mg |
| Catalog No.: | CN05085 |
| CAS No.: | 4443-09-8 |
| Molecular Formula: | C15H10O5 |
| Molecular Weight: | 270.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Scutellaria baicalensis Georgi |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc(O)c2c(c1O)oc(cc2=O)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Norwogonin, isolated from Scutellaria baicalensis Georgi, possesses antiviral activity against Enterovirus 71 (EV71) with an IC50 of 31.83 μg/ml[1] |
| Target | IC50: 31.83 μg/ml (EV71)[1] |
| In Vitro | Norwogonin (0.4, 2, 10, and 50 μg/mL; 48 hours) inhibits EV71 replication in Vero cells and prevents the cytotoxicity induced by EV71 infection[1]. Norwogonin (50 μg/mL; 48 hours) dramatically decreases viral VP2 protein expression[1]. Norwogonin (50 μg/mL; 48 hours) strongly decreases the expression of EV71 NCR gene at 48 h[1]. |
| Density | 1.548g/cm3 |
| Boiling Point | 528.4ºC at 760 mmHg |
| Flash Point | 206ºC |
| Exact Mass | 270.05300 |
| PSA | 90.90000 |
| LogP | 2.57680 |
| Storage condition | 2-8°C |