Home
Products
Tabersonine
| Product Name | Tabersonine |
| Price: | $62 / 20mg |
| Catalog No.: | CN02004 |
| CAS No.: | 4429-63-4 |
| Molecular Formula: | C21H24N2O2 |
| Molecular Weight: | 336.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Yellow powder |
| Source: | The root barks of Voacanga africana Stapf |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)C1=C2Nc3c([C@]42[C@H]2[C@](C1)(CC)C=CCN2CC4)cccc3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tabersonine is an indole alkaloid mainly isolated from Catharanthus roseus. Tabersonine disrupts Aβ(1-42) aggregation and ameliorates Aβ aggregate-induced cytotoxicity. Tabersonine has anti-inflammatory activities and acts as a potential therapeutic candidate for the treatment of ALI/ARDS[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 488.7±45.0 °C at 760 mmHg |
| Flash Point | 249.4±28.7 °C |
| Exact Mass | 336.183777 |
| PSA | 41.57000 |
| LogP | 3.57 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Storage condition | 2-8C |