Home
Products
Syringetin
| Product Name | Syringetin |
| Price: | $351 / 5mg |
| Catalog No.: | CN04339 |
| CAS No.: | 4423-37-4 |
| Molecular Formula: | C17H14O8 |
| Molecular Weight: | 346.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Philydrum lanuginosum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(cc(c1O)OC)c1oc2cc(O)cc(c2c(=O)c1O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Syringetin, a flavonoid derivative, is associated with increased BMP-2 production. Syringetin stimulates osteoblast differentiation at various stages, from maturation to terminally differentiated osteoblasts[1]. |
| Density | 1.591 g/cm3 |
| Boiling Point | 622.4ºC at 760mmHg |
| Flash Point | 1.591ºC |
| Exact Mass | 346.06900 |
| PSA | 129.59000 |
| LogP | 2.29960 |