Home
Products
Gentisin
| Product Name | Gentisin |
| Price: | Inquiry |
| Catalog No.: | CN05746 |
| CAS No.: | 437-50-3 |
| Molecular Formula: | C14H10O5 |
| Molecular Weight: | 258.22 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Powder |
| Source: | The roots of Gentiana lutea. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c2c(c1)oc1c(c2=O)cc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Gentisin is a natural compound isolated from Gentianae radix (Gentianaceae) with mutagenic activities[1]. |
| Density | 1.48g/cm3 |
| Boiling Point | 519.9ºC at 760mmHg |
| Flash Point | 205.2ºC |
| Exact Mass | 258.05300 |
| PSA | 79.90000 |
| LogP | 2.36600 |
| Vapour Pressure | 1.99E-11mmHg at 25°C |