Home
Products
Ajmaline
| Product Name | Ajmaline |
| Price: | Inquiry |
| Catalog No.: | CN01084 |
| CAS No.: | 4360-12-7 |
| Molecular Formula: | C20H26N2O2 |
| Molecular Weight: | 326.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Rauvolfia verticillata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC[C@H]1[C@@H]2C[C@@H]3N([C@@H]1O)[C@@H]1[C@H]2[C@@H](O)[C@@]2([C@H]3N(C)c3c2cccc3)C1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ajmaline is an alkaloid that is class Ia antiarrhythmic agent. |
| Density | 1.373g/cm3 |
| Boiling Point | 519.406ºC at 760 mmHg |
| Flash Point | 285.155ºC |
| Exact Mass | 326.19900 |
| PSA | 46.94000 |
| LogP | 1.55740 |
| Storage condition | -20℃ |