Home
Products
(-)-Curine
| Product Name | (-)-Curine |
| Price: | $117 / 5mg |
| Catalog No.: | CN01212 |
| CAS No.: | 436-05-5 |
| Molecular Formula: | C36H38N2O6 |
| Molecular Weight: | 594.69 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Cyclea polypetala Dunn. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2CCN(C3c2cc1Oc1cc(ccc1O)CC1N(C)CCc2c1c(Oc1ccc(C3)cc1)c(c(c2)OC)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (-)-Curine is an orally active bisbenzylisoquinoline alkaloid isolated from Chondrodendron platyphyllum. (-)-Curine presents anti-inflammatory and analgesic effects at nontoxic doses, at least in part, resulting from the inhibition of prostaglandin E2 production[1]. |
| Target | EP2 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 706.5±60.0 °C at 760 mmHg |
| Flash Point | 381.1±32.9 °C |
| Exact Mass | 594.273010 |
| PSA | 83.86000 |
| LogP | 4.12 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Storage condition | 2-8℃ |