Home
Products
Benzyl beta-D-glucopyranoside
| Product Name | Benzyl beta-D-glucopyranoside |
| Price: | Inquiry |
| Catalog No.: | CN03255 |
| CAS No.: | 4304-12-5 |
| Molecular Formula: | C13H18O6 |
| Molecular Weight: | 270.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The peels of Salix alba L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OCc2ccccc2)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.4g/cm3 |
| Boiling Point | 480.2ºC at 760 mmHg |
| Flash Point | 244.2ºC |
| Exact Mass | 270.11000 |
| PSA | 99.38000 |
| Storage condition | -20°C Freezer |