Home
Products
Vinpocetine
| Product Name | Vinpocetine |
| Price: | $31 / 20mg |
| Catalog No.: | CN01284 |
| CAS No.: | 42971-09-5 |
| Molecular Formula: | C22H26N2O2 |
| Molecular Weight: | 350.45 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Cryst. |
| Source: | The herbs of Catharanthus roseus (L.) G. Don. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCOC(=O)C1=C[C@]2(CC)CCCN3[C@@H]2c2n1c1ccccc1c2CC3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Vinpocetine(Cavinton; Ethyl apovincaminate) is a selective for PDE1 (IC50 = 21 μM). Also blocks voltage-gated Na+ channels.IC50 value:Target: PDE1; Na+ channel |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 419.5±45.0 °C at 760 mmHg |
| Flash Point | 207.5±28.7 °C |
| Exact Mass | 350.199432 |
| PSA | 34.47000 |
| LogP | 5.14 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |