Home
Products
Tilianin
| Product Name | Tilianin |
| Price: | $77 / 10mg |
| Catalog No.: | CN04995 |
| CAS No.: | 4291-60-5 |
| Molecular Formula: | C22H22O10 |
| Molecular Weight: | 446.1 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Tilia japonica. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(O)c3c(c2)oc(cc3=O)c2ccc(cc2)OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tilianin is a flavonoid glycoside of Dragocephalum moldavicum L.[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 754.9±60.0 °C at 760 mmHg |
| Flash Point | 265.5±26.4 °C |
| Exact Mass | 446.121307 |
| PSA | 159.05000 |
| LogP | 0.66 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |