Home
Products
Dehydrodiconiferyl alcohol
| Product Name | Dehydrodiconiferyl alcohol |
| Price: | Inquiry |
| Catalog No.: | CN02766 |
| CAS No.: | 4263-87-0 |
| Molecular Formula: | C20H22O6 |
| Molecular Weight: | 358.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The stems of Cucurbita moschata. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC/C=C/c1cc2c(c(c1)OC)OC(C2CO)c1ccc(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dehydrodiconiferyl alcohol is an estrogen receptor agonist that can promote BMP-2-induced osteoblastogenesis. Dehydrodiconiferyl alcohol also exerts anti-inflammatory activity through inactivation of NF-κB pathways[1][2]. |
| Density | 1.292g/cm3 |
| Boiling Point | 562ºC at 760mmHg |
| Flash Point | 293.7ºC |
| Exact Mass | 358.14200 |
| PSA | 88.38000 |
| LogP | 2.62450 |