Home
Products
Triacetylresveratrol
| Product Name | Triacetylresveratrol |
| Price: | $15 / 20mg |
| Catalog No.: | CN03679 |
| CAS No.: | 42206-94-0 |
| Molecular Formula: | C20H18O6 |
| Molecular Weight: | 354.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Polygonum cuspidatum Sieb. et Zucc. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)Oc1ccc(cc1)/C=C/c1cc(OC(=O)C)cc(c1)OC(=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Triacetylresveratrol, an acetylated analog of Resveratrol. Triacetylresveratrol decreases the phosphorylation of STAT3 and NF-κB in a dose- and time- dependent manner in PANC-1 and BxPC-3 cells. Anticancer effects[1]. |
| Target | NF-κB STAT3 |
| In Vitro | Triacetylresveratrol significantly down-regulates anti-apoptotic Bcl-2 family protein Mcl-1 and up-regulates pro-apoptotic Bcl-2 family proteins Bim and Puma. Triacetylresveratrol inhibits cell viability, and induces apoptosis of pancreatic cancer cells in a concentration and incubation time-dependent manner[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 504.8±50.0 °C at 760 mmHg |
| Flash Point | 221.4±30.2 °C |
| Exact Mass | 354.110352 |
| PSA | 78.90000 |
| LogP | 2.94 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | room temp |