Home
Products
Tetradehydropodophyllotoxin
| Product Name | Tetradehydropodophyllotoxin |
| Price: | $321 / 10mg |
| Catalog No.: | CN02615 |
| CAS No.: | 42123-27-3 |
| Molecular Formula: | C22H18O8 |
| Molecular Weight: | 410.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The roots of Dysosma versipellis (Hance) M.Cheng ex Ying |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(cc(c1OC)OC)c1c2C(=O)OCc2c(c2c1cc1OCOc1c2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tetradehydropodophyllotoxin possesses antifungal activity[1]. |
| Density | 1.429±0.06 g/cm3 |
| Exact Mass | 410.10000 |
| PSA | 92.68000 |
| LogP | 3.63730 |
| Storage condition | 2-8℃ |