Home
Products
5-Methoxyflavone
| Product Name | 5-Methoxyflavone |
| Price: | Inquiry |
| Catalog No.: | CN04313 |
| CAS No.: | 42079-78-7 |
| Molecular Formula: | C16H12O3 |
| Molecular Weight: | 252.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cccc2c1c(=O)cc(o2)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 5-Methoxyflavone, belonged to Flavonoid family, is a DNA polymerase-beta inhibitor and neuroprotective agent against beta-amyloid toxicity. possess central nervous system (CNS) depressant effect mediated through the ionotropic GABAA receptors. |
| Target | DNA polymerase-beta[1]. |
| In Vitro | 5-Methoxyflavone (compound 1) is identified as a candidate compound endowed with the ability to inhibit DNA pol-β in multiple and to prevent cell-cycle initiation and subsequent neuronal apoptosis in Aβ-challenged primary neuronal cultures. 5-methoxyflavone (10-30 μM) is able to significantly enhance toxicity of MMS on 92TAg cells. 5-Methoxyflavone (1 or 10 μM) significantly reduces polymerase activity on a gapped substrate[1]. 5-Methoxyflavone (5-MF, 0-100 μg/mL) results in a time dependent reduction in the levels of antiapoptotic proteins cFLIP, Mcl-1 and an increase in the proapoptotic protein BAX. 5-MF induces both TRAIL-R1(DR4) and TRAIL-R2 (DR5) in a time-dependent manner[2]. |
| In Vivo | 5-Methoxyflavone (100, 150 mg/kg, i.p) significantly decreases the latency time to loss of righting reflex. 5-Methoxyflavone (50, 100 and 150 mg/kg, i.p) exhibits a significant and dose-dependent reduction in the spontaneous locomotor activity. 5-Methoxyflavone (50, 100 mg/kg, i.p) reduces the rearing response. 5-Methoxyflavone (100, 125 and 150 mg/kg, i.p) completely abolishesed the grooming response similar to diazepam treated animals[3]. |
| Density | 1.24g/cm3 |
| Boiling Point | 422.5ºC at 760mmHg |
| Flash Point | 201.1ºC |
| Exact Mass | 252.07900 |
| PSA | 39.44000 |
| LogP | 3.46860 |