Home
Products
trans-3,5-Dimethoxy-4-hydroxy cinnamaldehyde
| Product Name | trans-3,5-Dimethoxy-4-hydroxy cinnamaldehyde |
| Price: | $46 / 10mg |
| Catalog No.: | CN06782 |
| CAS No.: | 4206-58-0 |
| Molecular Formula: | C11H12O4 |
| Molecular Weight: | 208.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(/C=C/C=O)cc(c1O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sinapaldehyde, isolated from the stems of Rhodamnia dumetorum, exhibits moderate antibacterial against Methicillin resistant S. aureus (MRSA) and E. coli with MIC values of 128 and 128 μg/mL[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 372.3±37.0 °C at 760 mmHg |
| Flash Point | 146.3±20.0 °C |
| Exact Mass | 208.073563 |
| PSA | 55.76000 |
| LogP | 1.00 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Storage condition | 2-8°C |