Home
Products
Pinocembrin chalcone
| Product Name | Pinocembrin chalcone |
| Price: | $380 / 10mg |
| Catalog No.: | CN05632 |
| CAS No.: | 4197-97-1 |
| Molecular Formula: | C15H12O4 |
| Molecular Weight: | 256.25 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Boesenbergia pandurata. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc(O)c(c(c1)O)C(=O)C=Cc1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pinocembrin chalcone (2',4',6'-Trihydroxychalcone) is an antibacterial compound from Helichrysum Trilineatum. Pinocembrin chalcone can prevent gastric ulcers in rats[1]. |
| Exact Mass | 256.07400 |
| PSA | 77.76000 |
| LogP | 2.69950 |