Home
Products
Trilobatin
| Product Name | Trilobatin |
| Price: | $31 / 20mg |
| Catalog No.: | CN05683 |
| CAS No.: | 4192-90-9 |
| Molecular Formula: | C21H24O10 |
| Molecular Weight: | 436.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Powder |
| Source: | The herbs of Lithocarpus pachyphyllus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(O)c(c(c2)O)C(=O)CCc2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Trilobatin, a natural sweetener derived from Lithocarpus polystachyus Rehd[1], Trilobatin is an HIV-1 entry inhibitor targeting the HIV-1 Gp41 envelope[2]. Neuroprotective effects[1]. Trilobatin is also a SGLT1/2 inhibitor that selectively induces the proliferation of human hepatoblastoma cells[3]. |
| Target | HIV-1 SGLT1/2 |
| In Vitro | Trilobatin protects against oxidative injury in neuronal PC12 cells through regulating mitochondrial reactive oxygen species (mtROS) homeostasis in the first time, which is, at least partly, mediated through the AMPK/Nrf2/Sirt3 signaling pathway[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 787.9±60.0 °C at 760 mmHg |
| Flash Point | 277.1±26.4 °C |
| Exact Mass | 436.136932 |
| PSA | 177.14000 |
| LogP | 1.43 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |