Home
Products
14-Deoxyandrographolide
| Product Name | 14-Deoxyandrographolide |
| Price: | $146 / 10mg |
| Catalog No.: | CN08566 |
| CAS No.: | 4176-97-0 |
| Molecular Formula: | C20H30O4 |
| Molecular Weight: | 334.45 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Andrographis paniculata (Burm. f.) Nees |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@]1(C)[C@H](O)CC[C@@]2([C@@H]1CCC(=C)[C@H]2CCC1=CCOC1=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 14-Deoxyandrographolide, a bioactive compound of Andrographis paniculata, has hepatoprotective efficacy. 14-Deoxyandrographolide desensitizes hepatocytes to TNF-α-mediated apoptosis through the release of TNFRSF1A release[1]. |
| Density | 1.15g/cm3 |
| Boiling Point | 509.5ºC at 760 mmHg |
| Flash Point | 177.3ºC |
| Exact Mass | 334.21400 |
| PSA | 66.76000 |
| LogP | 2.99180 |
| Storage condition | 2-8℃ |