Home
Products
Procyanidin A2
| Product Name | Procyanidin A2 |
| Price: | $117 / 5mg |
| Catalog No.: | CN04744 |
| CAS No.: | 41743-41-3 |
| Molecular Formula: | C30H24O12 |
| Molecular Weight: | 576.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Daemonorops draco. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc(O)c2c(c1)O[C@@]1([C@@H]([C@H]2c2c(O1)cc(c1c2O[C@@H]([C@@H](C1)O)c1ccc(c(c1)O)O)O)O)c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Procyanidin A2 is a flavonoid found in cranberries and lingonberries, with anti-cancer, antioxidant, antimicrobial and anti-inflammation activity[1][2]. |
| Target | Bacterial[1] |
| In Vitro | Procyanidin A2 shows DPPH radical scavenging activity, with an IC50 of 5.08 ± 0.37 μM[1]. |
| Density | 1.766g/cm3 |
| Boiling Point | 946ºC at 760 mmHg |
| Flash Point | 525.9ºC |
| Exact Mass | 576.12700 |
| PSA | 209.76000 |
| LogP | 2.79350 |
| Storage condition | 2-8°C |