Home
Products
Epimagnolin A
| Product Name | Epimagnolin A |
| Price: | $293 / 5mg |
| Catalog No.: | CN02701 |
| CAS No.: | 41689-51-4 |
| Molecular Formula: | C23H28O7 |
| Molecular Weight: | 416.46 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The dried flower buds of Magnolia biondii Pamp. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(ccc1OC)C1OCC2C1COC2c1cc(OC)c(c(c1)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Epimagnolin A, a furfuran lignan, shows mild antiplasmodial activities (IC50=5.7 μg/mL) without noticeable toxicity on mammalian normal cells[1]. |