Home
Products
3',4'-Dihydroxyflavone
| Product Name | 3',4'-Dihydroxyflavone |
| Price: | Inquiry |
| Catalog No.: | CN04341 |
| CAS No.: | 4143-64-0 |
| Molecular Formula: | C15H10O4 |
| Molecular Weight: | 254.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Cassia occidentalis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1O)c1cc(=O)c2c(o1)cccc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3',4'-Dihydroxyflavone is a flavonoid. 3',4'-Dihydroxyflavone has antiallergic activity with an IC50 value of 30 μM. 3',4'-Dihydroxyflavone can be used for the research of type I allergy[1]. |
| Target | IC50: 30 μM (antiallergic activity)[1] |
| Density | 1.443 g/cm3 |
| Boiling Point | 482.3ºC at 760 mmHg |
| Flash Point | 188.4ºC |
| Exact Mass | 254.05800 |
| PSA | 70.67000 |
| LogP | 2.87120 |