Home
Products
4'-Hydroxyflavone
| Product Name | 4'-Hydroxyflavone |
| Price: | $46 / 20mg |
| Catalog No.: | CN04173 |
| CAS No.: | 4143-63-9 |
| Molecular Formula: | C15H10O3 |
| Molecular Weight: | 238.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Phlomis umbrosa |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)c1cc(=O)c2c(o1)cccc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.34g/cm3 |
| Boiling Point | 425.8ºC at 760mmHg |
| Flash Point | 165.7ºC |
| Exact Mass | 238.06300 |
| PSA | 50.44000 |
| LogP | 3.16560 |