Home
Products
Steviolbioside
| Product Name | Steviolbioside |
| Price: | $92 / 20mg |
| Catalog No.: | CN08442 |
| CAS No.: | 41093-60-1 |
| Molecular Formula: | C32H50O13 |
| Molecular Weight: | 642.73 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The leaves of Stevia rebaudia |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC23CCC4C(C2)(CC3=C)CCC2C4(C)CCCC2(C)C(=O)O)C(C(C1O)O)OC1OC(CO)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Steviolbioside is a rare sweetener that exists in stevia rebaudiana leaves. Steviolbioside presents inhibition on several human cancer cells and acts as potential remedy for human breast cancer[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 847.3±65.0 °C at 760 mmHg |
| Flash Point | 267.6±27.8 °C |
| Exact Mass | 642.325134 |
| PSA | 215.83000 |
| LogP | 2.20 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | -20℃ |