Home
Products
Desacetylcinobufotalin
| Product Name | Desacetylcinobufotalin |
| Price: | Inquiry |
| Catalog No.: | CN02324 |
| CAS No.: | 4099-30-3 |
| Molecular Formula: | C24H32O6 |
| Molecular Weight: | 416.51 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The glandular body of Bufo bufo gargarizans Cantor. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1CC[C@]2([C@](C1)(O)CC[C@@H]1[C@@H]2CC[C@]2([C@]31O[C@@H]3[C@@H]([C@@H]2c1ccc(=O)oc1)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Desacetylcinobufotalin is a natural compound; apoptosis inducer and shows the marked inhibition effect to HepG2 cells and the IC50 value is 0.0279μmol/ml. |
| Density | 1.37±0.1 g/cm3 |
| Boiling Point | 636.7±55.0 °C at 760 mmHg |
| Flash Point | 220.4±25.0 °C |
| Exact Mass | 416.219879 |
| PSA | 103.43000 |
| LogP | 0.35 |
| Vapour Pressure | 0.0±4.3 mmHg at 25°C |
| Storage condition | 2-8℃ |