Home
Products
Glycitein
| Product Name | Glycitein |
| Price: | $71 / 20mg |
| Catalog No.: | CN05559 |
| CAS No.: | 40957-83-3 |
| Molecular Formula: | C16H12O5 |
| Molecular Weight: | 284.26 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow Powder |
| Source: | The fruits of Glycine max (L.) merr. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2c(cc1O)occ(c2=O)c1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Glycitein is a soybean (yellow cultivar) isoflavonoid; used in combination with other isoflavonoids such as genistein and daidzein to study apoptosis and anti-oxidation processes. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 547.4±50.0 °C at 760 mmHg |
| Flash Point | 210.1±23.6 °C |
| Exact Mass | 284.068481 |
| PSA | 79.90000 |
| LogP | 2.57 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | −20°C |