Home
Products
Sinoacutine
| Product Name | Sinoacutine |
| Price: | $146 / 5mg |
| Catalog No.: | CN02028 |
| CAS No.: | 4090-18-0 |
| Molecular Formula: | C19H21NO4 |
| Molecular Weight: | 327.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Stephania epigaea Lo |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC1=CC23CCN(C(C2=CC1=O)Cc1c3c(O)c(cc1)OC)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (-)-Salutaridine (Salutaridine) is an alkaloid isolated from the stems of Sinomenium acutum[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 532.5±50.0 °C at 760 mmHg |
| Flash Point | 275.8±30.1 °C |
| Exact Mass | 327.147064 |
| PSA | 59.00000 |
| LogP | 1.46 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | -20℃ |