Home
Products
Violanthin
| Product Name | Violanthin |
| Price: | $439 / 10mg |
| Catalog No.: | CN04271 |
| CAS No.: | 40581-17-7 |
| Molecular Formula: | C27H30O14 |
| Molecular Weight: | 578.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Piper bavinum |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(C(C(C1O)O)O)c1c(O)c(C2OC(C)C(C(C2O)O)O)c2c(c1O)c(=O)cc(o2)c1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Violanthin is isolated from the aerial parts of Piper bavinum, has potent antioxidant and antibacterial activities. Violanthin inhibits acetylcholinesterase (AChE) with an IC50 value of 79.80 μM[1]. |
| Target | IC50: 79.80 μM (AChE)[1] |
| Exact Mass | 578.16400 |
| PSA | 250.97000 |