Home
Products
4'-Demethylpodophyllotoxin
| Product Name | 4'-Demethylpodophyllotoxin |
| Price: | Inquiry |
| Catalog No.: | CN02885 |
| CAS No.: | 40505-27-9 |
| Molecular Formula: | C21H20O8 |
| Molecular Weight: | 400.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The herbs of Dysosma pleiantha (Hance) Woodson. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(cc(c1O)OC)[C@H]1[C@H]2C(=O)OC[C@@H]2[C@H](c2c1cc1OCOc1c2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 4'-Demethylpodophyllotoxin is an aryltetralin lignin contained in the root of Podophyllum hexandrum and P. peltatum. 4'-Demethylpodophyllotoxin exhibits cytotoxic potential in diverse cancer cell lines[1][2]. |
| Density | 1.446 g/cm3 |
| Boiling Point | 626.5ºC at 760 mmHg |
| Flash Point | 224.4ºC |
| Exact Mass | 400.11600 |
| PSA | 103.68000 |
| LogP | 2.10620 |
| Storage condition | -20℃ |